C21H27NO3 — CID 118252261
ethyl (2S,4S)-4-amino-2-(methoxymethyl)-5-(4-phenylphenyl)pentanoate (PubChem CID 118252261) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is ethyl (2S,4S)-4-amino-2-(methoxymethyl)-5-(4-phenylphenyl)pentanoate.
| Compound Name | ethyl (2S,4S)-4-amino-2-(methoxymethyl)-5-(4-phenylphenyl)pentanoate |
|---|---|
| PubChem CID | 118252261 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | ethyl (2S,4S)-4-amino-2-(methoxymethyl)-5-(4-phenylphenyl)pentanoate |
| SMILES | CCOC(=O)[C@H](COC)C[C@H](N)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27NO3/c1-3-25-21(23)19(15-24-2)14-20(22)13-16-9-11-18(12-10-16)17-7-5-4-6-8-17/h4-12,19-20H,3,13-15,22H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | PZWFBQRSOJMXPN-VQTJNVASSA-N |
| XLogP | 3.44 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |