C24H33BO5 — CID 160894241
[(2S,4S)-5-ethoxy-4-(2-hydroxyethoxymethyl)-5-oxo-2-[(4-phenylphenyl)methyl]pentyl]-methylborinic acid (PubChem CID 160894241) has the molecular formula C24H33BO5 and a molecular weight of 412.34 g/mol. Its IUPAC name is [(2S,4S)-5-ethoxy-4-(2-hydroxyethoxymethyl)-5-oxo-2-[(4-phenylphenyl)methyl]pentyl]-methylborinic acid.
| Compound Name | [(2S,4S)-5-ethoxy-4-(2-hydroxyethoxymethyl)-5-oxo-2-[(4-phenylphenyl)methyl]pentyl]-methylborinic acid |
|---|---|
| PubChem CID | 160894241 |
| Molecular Formula | C24H33BO5 |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | [(2S,4S)-5-ethoxy-4-(2-hydroxyethoxymethyl)-5-oxo-2-[(4-phenylphenyl)methyl]pentyl]-methylborinic acid |
| SMILES | CCOC(=O)[C@H](COCCO)C[C@H](CB(C)O)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H33BO5/c1-3-30-24(27)23(18-29-14-13-26)16-20(17-25(2)28)15-19-9-11-22(12-10-19)21-7-5-4-6-8-21/h4-12,20,23,26,28H,3,13-18H2,1-2H3/t20-,23+/m1/s1 |
| InChIKey | STSSVXSAGXFMQR-OFNKIYASSA-N |
| XLogP | 3.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|