C23H31NO2 — CID 149424437
(7S)-7-amino-5-(ethoxymethyl)-8-(4-phenylphenyl)octan-4-one (PubChem CID 149424437) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (7S)-7-amino-5-(ethoxymethyl)-8-(4-phenylphenyl)octan-4-one.
| Compound Name | (7S)-7-amino-5-(ethoxymethyl)-8-(4-phenylphenyl)octan-4-one |
|---|---|
| PubChem CID | 149424437 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (7S)-7-amino-5-(ethoxymethyl)-8-(4-phenylphenyl)octan-4-one |
| SMILES | CCCC(=O)C(COCC)C[C@H](N)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H31NO2/c1-3-8-23(25)21(17-26-4-2)16-22(24)15-18-11-13-20(14-12-18)19-9-6-5-7-10-19/h5-7,9-14,21-22H,3-4,8,15-17,24H2,1-2H3/t21?,22-/m1/s1 |
| InChIKey | YTUXQGNPTNCNJI-FOIFJWKZSA-N |
| XLogP | 4.64 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |