C20H25NO2 — CID 11722991
ethyl (2R,4R)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate (PubChem CID 11722991) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is ethyl (2R,4R)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate.
| Compound Name | ethyl (2R,4R)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate |
|---|---|
| PubChem CID | 11722991 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | ethyl (2R,4R)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate |
| SMILES | CCOC(=O)[C@H](C)C[C@@H](N)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H25NO2/c1-3-23-20(22)15(2)13-19(21)14-16-9-11-18(12-10-16)17-7-5-4-6-8-17/h4-12,15,19H,3,13-14,21H2,1-2H3/t15-,19-/m1/s1 |
| InChIKey | OKDSPZRSANXDRL-DNVCBOLYSA-N |
| XLogP | 3.81 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |