C27H29NO3 — CID 141281932
ethyl (2R,4S)-4-benzamido-2-methyl-5-(4-phenylphenyl)pentanoate (PubChem CID 141281932) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is ethyl (2R,4S)-4-benzamido-2-methyl-5-(4-phenylphenyl)pentanoate.
| Compound Name | ethyl (2R,4S)-4-benzamido-2-methyl-5-(4-phenylphenyl)pentanoate |
|---|---|
| PubChem CID | 141281932 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | ethyl (2R,4S)-4-benzamido-2-methyl-5-(4-phenylphenyl)pentanoate |
| SMILES | CCOC(=O)[C@H](C)C[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H29NO3/c1-3-31-27(30)20(2)18-25(28-26(29)24-12-8-5-9-13-24)19-21-14-16-23(17-15-21)22-10-6-4-7-11-22/h4-17,20,25H,3,18-19H2,1-2H3,(H,28,29)/t20-,25+/m1/s1 |
| InChIKey | HYLYJCJDFXBZJG-NLFFAJNJSA-N |
| XLogP | 5.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |