C27H35NO5 — CID 57204865
ethyl (2R,4S)-4-[(6-methoxy-6-oxohexanoyl)amino]-2-methyl-5-(4-phenylphenyl)pentanoate (PubChem CID 57204865) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[(6-methoxy-6-oxohexanoyl)amino]-2-methyl-5-(4-phenylphenyl)pentanoate.
| Compound Name | ethyl (2R,4S)-4-[(6-methoxy-6-oxohexanoyl)amino]-2-methyl-5-(4-phenylphenyl)pentanoate |
|---|---|
| PubChem CID | 57204865 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | ethyl (2R,4S)-4-[(6-methoxy-6-oxohexanoyl)amino]-2-methyl-5-(4-phenylphenyl)pentanoate |
| SMILES | CCOC(=O)[C@H](C)C[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)CCCCC(=O)OC |
| InChI | InChI=1S/C27H35NO5/c1-4-33-27(31)20(2)18-24(28-25(29)12-8-9-13-26(30)32-3)19-21-14-16-23(17-15-21)22-10-6-5-7-11-22/h5-7,10-11,14-17,20,24H,4,8-9,12-13,18-19H2,1-3H3,(H,28,29)/t20-,24+/m1/s1 |
| InChIKey | ACYUNORCYOKEPA-YKSBVNFPSA-N |
| XLogP | 4.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|