C29H33ClFNO3 — CID 129189570
benzyl (2S,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoate (PubChem CID 129189570) has the molecular formula C29H33ClFNO3 and a molecular weight of 498.04 g/mol. Its IUPAC name is benzyl (2S,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoate.
| Compound Name | benzyl (2S,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoate |
|---|---|
| PubChem CID | 129189570 |
| Molecular Formula | C29H33ClFNO3 |
| Molecular Weight | 498.04 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | benzyl (2S,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoate |
| SMILES | CCOCC[C@](C)(C[C@H](N)Cc1ccc(-c2cc(Cl)ccc2F)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H33ClFNO3/c1-3-34-16-15-29(2,28(33)35-20-22-7-5-4-6-8-22)19-25(32)17-21-9-11-23(12-10-21)26-18-24(30)13-14-27(26)31/h4-14,18,25H,3,15-17,19-20,32H2,1-2H3/t25-,29-/m1/s1 |
| InChIKey | PNLXBTMNUNQBNL-VAVYLYDRSA-N |
| XLogP | 6.58 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.04 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|