C19H22ClFN2O2 — CID 123922584
ethyl 2,4-diamino-5-[4-(5-chloro-2-fluorophenyl)phenyl]pentanoate (PubChem CID 123922584) has the molecular formula C19H22ClFN2O2 and a molecular weight of 364.85 g/mol. Its IUPAC name is ethyl 2,4-diamino-5-[4-(5-chloro-2-fluorophenyl)phenyl]pentanoate.
| Compound Name | ethyl 2,4-diamino-5-[4-(5-chloro-2-fluorophenyl)phenyl]pentanoate |
|---|---|
| PubChem CID | 123922584 |
| Molecular Formula | C19H22ClFN2O2 |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | ethyl 2,4-diamino-5-[4-(5-chloro-2-fluorophenyl)phenyl]pentanoate |
| SMILES | CCOC(=O)C(N)CC(N)Cc1ccc(-c2cc(Cl)ccc2F)cc1 |
| InChI | InChI=1S/C19H22ClFN2O2/c1-2-25-19(24)18(23)11-15(22)9-12-3-5-13(6-4-12)16-10-14(20)7-8-17(16)21/h3-8,10,15,18H,2,9,11,22-23H2,1H3 |
| InChIKey | YIZKWIZGNKFFFM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |