C20H23Cl2FN2O2 — CID 118190901
ethyl (4S)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-4-(2-chlorohydrazinyl)-2-methylpentanoate (PubChem CID 118190901) has the molecular formula C20H23Cl2FN2O2 and a molecular weight of 413.32 g/mol. Its IUPAC name is ethyl (4S)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-4-(2-chlorohydrazinyl)-2-methylpentanoate.
| Compound Name | ethyl (4S)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-4-(2-chlorohydrazinyl)-2-methylpentanoate |
|---|---|
| PubChem CID | 118190901 |
| Molecular Formula | C20H23Cl2FN2O2 |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | ethyl (4S)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-4-(2-chlorohydrazinyl)-2-methylpentanoate |
| SMILES | CCOC(=O)C(C)C[C@@H](Cc1ccc(-c2cc(Cl)ccc2F)cc1)NNCl |
| InChI | InChI=1S/C20H23Cl2FN2O2/c1-3-27-20(26)13(2)10-17(24-25-22)11-14-4-6-15(7-5-14)18-12-16(21)8-9-19(18)23/h4-9,12-13,17,24-25H,3,10-11H2,1-2H3/t13?,17-/m0/s1 |
| InChIKey | CJNIGRAGQWGINB-RUINGEJQSA-N |
| XLogP | 4.89 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|