C24H27ClFNO6 — CID 134170662
(4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-4-[(2-ethoxy-2-oxoacetyl)amino]-2-(2-hydroxyethyl)-2-methylpentanoic acid (PubChem CID 134170662) has the molecular formula C24H27ClFNO6 and a molecular weight of 479.93 g/mol. Its IUPAC name is (4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-4-[(2-ethoxy-2-oxoacetyl)amino]-2-(2-hydroxyethyl)-2-methylpentanoic acid.
| Compound Name | (4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-4-[(2-ethoxy-2-oxoacetyl)amino]-2-(2-hydroxyethyl)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 134170662 |
| Molecular Formula | C24H27ClFNO6 |
| Molecular Weight | 479.93 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | (4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-4-[(2-ethoxy-2-oxoacetyl)amino]-2-(2-hydroxyethyl)-2-methylpentanoic acid |
| SMILES | CCOC(=O)C(=O)N[C@H](Cc1ccc(-c2cc(Cl)ccc2F)cc1)CC(C)(CCO)C(=O)O |
| InChI | InChI=1S/C24H27ClFNO6/c1-3-33-22(30)21(29)27-18(14-24(2,10-11-28)23(31)32)12-15-4-6-16(7-5-15)19-13-17(25)8-9-20(19)26/h4-9,13,18,28H,3,10-12,14H2,1-2H3,(H,27,29)(H,31,32)/t18-,24?/m1/s1 |
| InChIKey | FFUUNQDLHZBUNL-QFADGXAASA-N |
| XLogP | 3.60 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.93 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|