C21H22ClFN2O5 — CID 122447009
(2S,4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(hydroxymethyl)-2-methyl-4-(oxamoylamino)pentanoic acid (PubChem CID 122447009) has the molecular formula C21H22ClFN2O5 and a molecular weight of 436.87 g/mol. Its IUPAC name is (2S,4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(hydroxymethyl)-2-methyl-4-(oxamoylamino)pentanoic acid.
| Compound Name | (2S,4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(hydroxymethyl)-2-methyl-4-(oxamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 122447009 |
| Molecular Formula | C21H22ClFN2O5 |
| Molecular Weight | 436.87 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (2S,4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(hydroxymethyl)-2-methyl-4-(oxamoylamino)pentanoic acid |
| SMILES | C[C@@](CO)(C[C@@H](Cc1ccc(-c2cc(Cl)ccc2F)cc1)NC(=O)C(N)=O)C(=O)O |
| InChI | InChI=1S/C21H22ClFN2O5/c1-21(11-26,20(29)30)10-15(25-19(28)18(24)27)8-12-2-4-13(5-3-12)16-9-14(22)6-7-17(16)23/h2-7,9,15,26H,8,10-11H2,1H3,(H2,24,27)(H,25,28)(H,29,30)/t15-,21+/m1/s1 |
| InChIKey | YDNRMISFQCGGIA-VFNWGFHPSA-N |
| XLogP | 2.13 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.87 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|