C22H27ClFNO3 — CID 129189574
(2S,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoic acid (PubChem CID 129189574) has the molecular formula C22H27ClFNO3 and a molecular weight of 407.91 g/mol. Its IUPAC name is (2S,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoic acid.
| Compound Name | (2S,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 129189574 |
| Molecular Formula | C22H27ClFNO3 |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (2S,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoic acid |
| SMILES | CCOCC[C@](C)(C[C@H](N)Cc1ccc(-c2cc(Cl)ccc2F)cc1)C(=O)O |
| InChI | InChI=1S/C22H27ClFNO3/c1-3-28-11-10-22(2,21(26)27)14-18(25)12-15-4-6-16(7-5-15)19-13-17(23)8-9-20(19)24/h4-9,13,18H,3,10-12,14,25H2,1-2H3,(H,26,27)/t18-,22-/m1/s1 |
| InChIKey | XKQLGQVTJUSWJN-XMSQKQJNSA-N |
| XLogP | 4.92 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|