C28H34ClFN4O4 — CID 139484287
(2S,4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-methyl-2-(2-pentoxyethyl)-4-(2H-triazole-4-carbonylamino)pentanoic acid (PubChem CID 139484287) has the molecular formula C28H34ClFN4O4 and a molecular weight of 545.06 g/mol. Its IUPAC name is (2S,4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-methyl-2-(2-pentoxyethyl)-4-(2H-triazole-4-carbonylamino)pentanoic acid.
| Compound Name | (2S,4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-methyl-2-(2-pentoxyethyl)-4-(2H-triazole-4-carbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 139484287 |
| Molecular Formula | C28H34ClFN4O4 |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | (2S,4R)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-methyl-2-(2-pentoxyethyl)-4-(2H-triazole-4-carbonylamino)pentanoic acid |
| SMILES | CCCCCOCC[C@](C)(C[C@@H](Cc1ccc(-c2cc(Cl)ccc2F)cc1)NC(=O)c1cn[nH]n1)C(=O)O |
| InChI | InChI=1S/C28H34ClFN4O4/c1-3-4-5-13-38-14-12-28(2,27(36)37)17-22(32-26(35)25-18-31-34-33-25)15-19-6-8-20(9-7-19)23-16-21(29)10-11-24(23)30/h6-11,16,18,22H,3-5,12-15,17H2,1-2H3,(H,32,35)(H,36,37)(H,31,33,34)/t22-,28-/m1/s1 |
| InChIKey | VZPDJLBNAHJGFS-SKCUWOTOSA-N |
| XLogP | 5.68 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|