C26H32N4O4 — CID 134262807
butyl (4R)-2-(hydroxymethyl)-2-methyl-5-(4-phenylphenyl)-4-(2H-triazole-4-carbonylamino)pentanoate (PubChem CID 134262807) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is butyl (4R)-2-(hydroxymethyl)-2-methyl-5-(4-phenylphenyl)-4-(2H-triazole-4-carbonylamino)pentanoate.
| Compound Name | butyl (4R)-2-(hydroxymethyl)-2-methyl-5-(4-phenylphenyl)-4-(2H-triazole-4-carbonylamino)pentanoate |
|---|---|
| PubChem CID | 134262807 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | butyl (4R)-2-(hydroxymethyl)-2-methyl-5-(4-phenylphenyl)-4-(2H-triazole-4-carbonylamino)pentanoate |
| SMILES | CCCCOC(=O)C(C)(CO)C[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C26H32N4O4/c1-3-4-14-34-25(33)26(2,18-31)16-22(28-24(32)23-17-27-30-29-23)15-19-10-12-21(13-11-19)20-8-6-5-7-9-20/h5-13,17,22,31H,3-4,14-16,18H2,1-2H3,(H,28,32)(H,27,29,30)/t22-,26?/m1/s1 |
| InChIKey | DHZORIMVZTVEMA-FPSALIRRSA-N |
| XLogP | 3.54 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|