C55H65F4N8O10Te — CID 159371507
CID 159371507 (PubChem CID 159371507) has the molecular formula C55H65F4N8O10Te and a molecular weight of 1201.76 g/mol.
| Compound Name | CID 159371507 |
|---|---|
| PubChem CID | 159371507 |
| Molecular Formula | C55H65F4N8O10Te |
| Molecular Weight | 1201.76 g/mol |
| Exact Mass | 1203.38 |
| IUPAC Name | — |
| SMILES | CC(F)(F)CO.CC(F)(F)COC(=O)[C@](C)(CO)C[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)c1cn[nH]n1.C[C@@](COC1CCCCO1)(C[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)c1cn([Te])nn1)C(=O)O |
| InChI | InChI=1S/C27H31N4O5Te.C25H28F2N4O4.C3H6F2O/c1-27(26(33)34,18-36-24-9-5-6-14-35-24)16-22(28-25(32)23-17-31(37)30-29-23)15-19-10-12-21(13-11-19)20-7-3-2-4-8-20;1-24(15-32,23(34)35-16-25(2,26)27)13-20(29-22(33)21-14-28-31-30-21)12-17-8-10-19(11-9-17)18-6-4-3-5-7-18;1-3(4,5)2-6/h2-4,7-8,10-13,17,22,24H,5-6,9,14-16,18H2,1H3,(H,28,32)(H,33,34);3-11,14,20,32H,12-13,15-16H2,1-2H3,(H,29,33)(H,28,30,31);6H,2H2,1H3/t22-,24?,27+;20-,24+;/m11./s1 |
| InChIKey | CKADCNCJLLOEMM-TXVCDEAXSA-N |
| XLogP | 7.28 |
| TPSA | 253.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 78 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1201.76 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|