C27H31N4O5Te — CID 159371508
CID 159371508 (PubChem CID 159371508) has the molecular formula C27H31N4O5Te and a molecular weight of 619.17 g/mol.
| Compound Name | CID 159371508 |
|---|---|
| PubChem CID | 159371508 |
| Molecular Formula | C27H31N4O5Te |
| Molecular Weight | 619.17 g/mol |
| Exact Mass | 621.14 |
| IUPAC Name | — |
| SMILES | C[C@@](COC1CCCCO1)(C[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)c1cn([Te])nn1)C(=O)O |
| InChI | InChI=1S/C27H31N4O5Te/c1-27(26(33)34,18-36-24-9-5-6-14-35-24)16-22(28-25(32)23-17-31(37)30-29-23)15-19-10-12-21(13-11-19)20-7-3-2-4-8-20/h2-4,7-8,10-13,17,22,24H,5-6,9,14-16,18H2,1H3,(H,28,32)(H,33,34)/t22-,24?,27+/m1/s1 |
| InChIKey | YQICSLJABZVDRY-BPMXUHRXSA-N |
| XLogP | 3.24 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|