C25H25NO5S — CID 10182459
N-(oxan-2-yloxy)-2-[(4-phenylphenyl)methylsulfonyl]benzamide (PubChem CID 10182459) has the molecular formula C25H25NO5S and a molecular weight of 451.54 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-2-[(4-phenylphenyl)methylsulfonyl]benzamide.
| Compound Name | N-(oxan-2-yloxy)-2-[(4-phenylphenyl)methylsulfonyl]benzamide |
|---|---|
| PubChem CID | 10182459 |
| Molecular Formula | C25H25NO5S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N-(oxan-2-yloxy)-2-[(4-phenylphenyl)methylsulfonyl]benzamide |
| SMILES | O=C(NOC1CCCCO1)c1ccccc1S(=O)(=O)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO5S/c27-25(26-31-24-12-6-7-17-30-24)22-10-4-5-11-23(22)32(28,29)18-19-13-15-21(16-14-19)20-8-2-1-3-9-20/h1-5,8-11,13-16,24H,6-7,12,17-18H2,(H,26,27) |
| InChIKey | YQIHIHQSAMRNBR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|