C24H31NO5S — CID 86668756
2-methyl-4-(2-methyl-4-phenylphenyl)-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide (PubChem CID 86668756) has the molecular formula C24H31NO5S and a molecular weight of 445.58 g/mol. Its IUPAC name is 2-methyl-4-(2-methyl-4-phenylphenyl)-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide.
| Compound Name | 2-methyl-4-(2-methyl-4-phenylphenyl)-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 86668756 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 2-methyl-4-(2-methyl-4-phenylphenyl)-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
| SMILES | Cc1cc(-c2ccccc2)ccc1CCC(C)(C(=O)NOC1CCCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C24H31NO5S/c1-18-17-21(20-9-5-4-6-10-20)13-12-19(18)14-15-24(2,31(3,27)28)23(26)25-30-22-11-7-8-16-29-22/h4-6,9-10,12-13,17,22H,7-8,11,14-16H2,1-3H3,(H,25,26) |
| InChIKey | SIDCSLJMPXKVHY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|