C17H24ClNO3 — CID 150816823
4-(2-chlorophenyl)-2,2-dimethyl-N-(oxan-2-yloxy)butanamide (PubChem CID 150816823) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-2,2-dimethyl-N-(oxan-2-yloxy)butanamide.
| Compound Name | 4-(2-chlorophenyl)-2,2-dimethyl-N-(oxan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 150816823 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 4-(2-chlorophenyl)-2,2-dimethyl-N-(oxan-2-yloxy)butanamide |
| SMILES | CC(C)(CCc1ccccc1Cl)C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C17H24ClNO3/c1-17(2,11-10-13-7-3-4-8-14(13)18)16(20)19-22-15-9-5-6-12-21-15/h3-4,7-8,15H,5-6,9-12H2,1-2H3,(H,19,20) |
| InChIKey | KJBCOWYPNJJUFZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|