C22H26F2N2O6S — CID 88880218
(2R)-4-(3,5-difluoro-2-oxo-4-phenyl-1-pyridinyl)-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide (PubChem CID 88880218) has the molecular formula C22H26F2N2O6S and a molecular weight of 484.52 g/mol. Its IUPAC name is (2R)-4-(3,5-difluoro-2-oxo-4-phenyl-1-pyridinyl)-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide.
| Compound Name | (2R)-4-(3,5-difluoro-2-oxo-4-phenyl-1-pyridinyl)-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 88880218 |
| Molecular Formula | C22H26F2N2O6S |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | (2R)-4-(3,5-difluoro-2-oxo-4-phenyl-1-pyridinyl)-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
| SMILES | C[C@@](CCn1cc(F)c(-c2ccccc2)c(F)c1=O)(C(=O)NOC1CCCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C22H26F2N2O6S/c1-22(33(2,29)30,21(28)25-32-17-10-6-7-13-31-17)11-12-26-14-16(23)18(19(24)20(26)27)15-8-4-3-5-9-15/h3-5,8-9,14,17H,6-7,10-13H2,1-2H3,(H,25,28)/t17?,22-/m1/s1 |
| InChIKey | YRSHFSFXUIYNEM-IVAFLUGOSA-N |
| XLogP | 2.56 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|