C23H28F2N2O7S — CID 86671946
(2R)-4-[4-(2,3-difluoro-4-methoxyphenyl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide (PubChem CID 86671946) has the molecular formula C23H28F2N2O7S and a molecular weight of 514.55 g/mol. Its IUPAC name is (2R)-4-[4-(2,3-difluoro-4-methoxyphenyl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide.
| Compound Name | (2R)-4-[4-(2,3-difluoro-4-methoxyphenyl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 86671946 |
| Molecular Formula | C23H28F2N2O7S |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | (2R)-4-[4-(2,3-difluoro-4-methoxyphenyl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
| SMILES | COc1ccc(-c2ccn(CC[C@](C)(C(=O)NOC3CCCCO3)S(C)(=O)=O)c(=O)c2)c(F)c1F |
| InChI | InChI=1S/C23H28F2N2O7S/c1-23(35(3,30)31,22(29)26-34-19-6-4-5-13-33-19)10-12-27-11-9-15(14-18(27)28)16-7-8-17(32-2)21(25)20(16)24/h7-9,11,14,19H,4-6,10,12-13H2,1-3H3,(H,26,29)/t19?,23-/m1/s1 |
| InChIKey | ZBIOMUWEVNMNHH-LEQGEALCSA-N |
| XLogP | 2.57 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|