C34H47FN2O9S — CID 86671923
(2R)-4-[4-[2-fluoro-4-[[4-(oxan-2-yloxy)cyclohexyl]methoxy]phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide (PubChem CID 86671923) has the molecular formula C34H47FN2O9S and a molecular weight of 678.82 g/mol. Its IUPAC name is (2R)-4-[4-[2-fluoro-4-[[4-(oxan-2-yloxy)cyclohexyl]methoxy]phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide.
| Compound Name | (2R)-4-[4-[2-fluoro-4-[[4-(oxan-2-yloxy)cyclohexyl]methoxy]phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 86671923 |
| Molecular Formula | C34H47FN2O9S |
| Molecular Weight | 678.82 g/mol |
| Exact Mass | 678.30 |
| IUPAC Name | (2R)-4-[4-[2-fluoro-4-[[4-(oxan-2-yloxy)cyclohexyl]methoxy]phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
| SMILES | C[C@@](CCn1ccc(-c2ccc(OCC3CCC(OC4CCCCO4)CC3)cc2F)cc1=O)(C(=O)NOC1CCCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C34H47FN2O9S/c1-34(47(2,40)41,33(39)36-46-32-8-4-6-20-43-32)16-18-37-17-15-25(21-30(37)38)28-14-13-27(22-29(28)35)44-23-24-9-11-26(12-10-24)45-31-7-3-5-19-42-31/h13-15,17,21-22,24,26,31-32H,3-12,16,18-20,23H2,1-2H3,(H,36,39)/t24?,26?,31?,32?,34-/m1/s1 |
| InChIKey | JFGINBBPGSTMGA-XQPVZZAPSA-N |
| XLogP | 4.90 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.82 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|