C28H32N2O7S — CID 129217681
(2R)-4-[6-(1,3-dihydro-2-benzofuran-5-yl)-1-oxoisoquinolin-2-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide (PubChem CID 129217681) has the molecular formula C28H32N2O7S and a molecular weight of 540.64 g/mol. Its IUPAC name is (2R)-4-[6-(1,3-dihydro-2-benzofuran-5-yl)-1-oxoisoquinolin-2-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide.
| Compound Name | (2R)-4-[6-(1,3-dihydro-2-benzofuran-5-yl)-1-oxoisoquinolin-2-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 129217681 |
| Molecular Formula | C28H32N2O7S |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | (2R)-4-[6-(1,3-dihydro-2-benzofuran-5-yl)-1-oxoisoquinolin-2-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
| SMILES | C[C@@](CCn1ccc2cc(-c3ccc4c(c3)COC4)ccc2c1=O)(C(=O)NOC1CCCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C28H32N2O7S/c1-28(38(2,33)34,27(32)29-37-25-5-3-4-14-36-25)11-13-30-12-10-21-15-20(8-9-24(21)26(30)31)19-6-7-22-17-35-18-23(22)16-19/h6-10,12,15-16,25H,3-5,11,13-14,17-18H2,1-2H3,(H,29,32)/t25?,28-/m1/s1 |
| InChIKey | NSIZLTYCEITPAB-MPSNESSQSA-N |
| XLogP | 3.47 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|