C23H26N2O6S — CID 129217598
(2R)-N-hydroxy-4-[6-[4-(2-hydroxyethyl)phenyl]-1-oxoisoquinolin-2-yl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 129217598) has the molecular formula C23H26N2O6S and a molecular weight of 458.54 g/mol. Its IUPAC name is (2R)-N-hydroxy-4-[6-[4-(2-hydroxyethyl)phenyl]-1-oxoisoquinolin-2-yl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-N-hydroxy-4-[6-[4-(2-hydroxyethyl)phenyl]-1-oxoisoquinolin-2-yl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 129217598 |
| Molecular Formula | C23H26N2O6S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | (2R)-N-hydroxy-4-[6-[4-(2-hydroxyethyl)phenyl]-1-oxoisoquinolin-2-yl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CCn1ccc2cc(-c3ccc(CCO)cc3)ccc2c1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C23H26N2O6S/c1-23(22(28)24-29,32(2,30)31)11-13-25-12-9-19-15-18(7-8-20(19)21(25)27)17-5-3-16(4-6-17)10-14-26/h3-9,12,15,26,29H,10-11,13-14H2,1-2H3,(H,24,28)/t23-/m1/s1 |
| InChIKey | FUJZWVRNFJXZBN-HSZRJFAPSA-N |
| XLogP | 1.90 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|