C29H34F3N3O9S — CID 137359911
2-[4-[2-[4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-1-oxoisoquinolin-6-yl]phenyl]ethyl 2-(dimethylamino)acetate;2,2,2-trifluoroacetic acid (PubChem CID 137359911) has the molecular formula C29H34F3N3O9S and a molecular weight of 657.66 g/mol. Its IUPAC name is 2-[4-[2-[4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-1-oxoisoquinolin-6-yl]phenyl]ethyl 2-(dimethylamino)acetate;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[2-[4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-1-oxoisoquinolin-6-yl]phenyl]ethyl 2-(dimethylamino)acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 137359911 |
| Molecular Formula | C29H34F3N3O9S |
| Molecular Weight | 657.66 g/mol |
| Exact Mass | 657.20 |
| IUPAC Name | 2-[4-[2-[4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-1-oxoisoquinolin-6-yl]phenyl]ethyl 2-(dimethylamino)acetate;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CC(=O)OCCc1ccc(-c2ccc3c(=O)n(CCC(C)(C(=O)NO)S(C)(=O)=O)ccc3c2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H33N3O7S.C2HF3O2/c1-27(26(33)28-34,38(4,35)36)13-15-30-14-11-22-17-21(9-10-23(22)25(30)32)20-7-5-19(6-8-20)12-16-37-24(31)18-29(2)3;3-2(4,5)1(6)7/h5-11,14,17,34H,12-13,15-16,18H2,1-4H3,(H,28,33);(H,6,7) |
| InChIKey | ZXMRIOXZRKTENR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 172.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.66 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|