C21H24ClN3O6S — CID 137360017
N-hydroxy-4-[6-(6-methoxy-3-pyridinyl)-1-oxoisoquinolin-2-yl]-2-methyl-2-methylsulfonylbutanamide;hydrochloride (PubChem CID 137360017) has the molecular formula C21H24ClN3O6S and a molecular weight of 481.96 g/mol. Its IUPAC name is N-hydroxy-4-[6-(6-methoxy-3-pyridinyl)-1-oxoisoquinolin-2-yl]-2-methyl-2-methylsulfonylbutanamide;hydrochloride.
| Compound Name | N-hydroxy-4-[6-(6-methoxy-3-pyridinyl)-1-oxoisoquinolin-2-yl]-2-methyl-2-methylsulfonylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 137360017 |
| Molecular Formula | C21H24ClN3O6S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-hydroxy-4-[6-(6-methoxy-3-pyridinyl)-1-oxoisoquinolin-2-yl]-2-methyl-2-methylsulfonylbutanamide;hydrochloride |
| SMILES | COc1ccc(-c2ccc3c(=O)n(CCC(C)(C(=O)NO)S(C)(=O)=O)ccc3c2)cn1.Cl |
| InChI | InChI=1S/C21H23N3O6S.ClH/c1-21(20(26)23-27,31(3,28)29)9-11-24-10-8-15-12-14(4-6-17(15)19(24)25)16-5-7-18(30-2)22-13-16;/h4-8,10,12-13,27H,9,11H2,1-3H3,(H,23,26);1H |
| InChIKey | BIFKWPMDJUPCIR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|