C24H28N2O7S — CID 90116058
N-hydroxy-4-[4-[6-(3-hydroxypropoxy)naphthalen-2-yl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 90116058) has the molecular formula C24H28N2O7S and a molecular weight of 488.56 g/mol. Its IUPAC name is N-hydroxy-4-[4-[6-(3-hydroxypropoxy)naphthalen-2-yl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | N-hydroxy-4-[4-[6-(3-hydroxypropoxy)naphthalen-2-yl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 90116058 |
| Molecular Formula | C24H28N2O7S |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | N-hydroxy-4-[4-[6-(3-hydroxypropoxy)naphthalen-2-yl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCn1ccc(-c2ccc3cc(OCCCO)ccc3c2)cc1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C24H28N2O7S/c1-24(23(29)25-30,34(2,31)32)9-11-26-10-8-20(16-22(26)28)17-4-5-19-15-21(33-13-3-12-27)7-6-18(19)14-17/h4-8,10,14-16,27,30H,3,9,11-13H2,1-2H3,(H,25,29) |
| InChIKey | WGJLADFYUMEINT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|