C21H27ClN2O7S — CID 90116035
4-[4-[2-chloro-4-(4-hydroxybutoxy)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 90116035) has the molecular formula C21H27ClN2O7S and a molecular weight of 486.97 g/mol. Its IUPAC name is 4-[4-[2-chloro-4-(4-hydroxybutoxy)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | 4-[4-[2-chloro-4-(4-hydroxybutoxy)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 90116035 |
| Molecular Formula | C21H27ClN2O7S |
| Molecular Weight | 486.97 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 4-[4-[2-chloro-4-(4-hydroxybutoxy)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCn1ccc(-c2ccc(OCCCCO)cc2Cl)cc1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C21H27ClN2O7S/c1-21(20(27)23-28,32(2,29)30)8-10-24-9-7-15(13-19(24)26)17-6-5-16(14-18(17)22)31-12-4-3-11-25/h5-7,9,13-14,25,28H,3-4,8,10-12H2,1-2H3,(H,23,27) |
| InChIKey | BYRQSMVGMXGNJL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.97 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|