C22H30N2O8S — CID 140640897
N-hydroxy-4-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 140640897) has the molecular formula C22H30N2O8S and a molecular weight of 482.56 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | N-hydroxy-4-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 140640897 |
| Molecular Formula | C22H30N2O8S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | N-hydroxy-4-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | COCCOCCOc1ccc(-c2ccn(CCC(C)(C(=O)NO)S(C)(=O)=O)c(=O)c2)cc1 |
| InChI | InChI=1S/C22H30N2O8S/c1-22(21(26)23-27,33(3,28)29)9-11-24-10-8-18(16-20(24)25)17-4-6-19(7-5-17)32-15-14-31-13-12-30-2/h4-8,10,16,27H,9,11-15H2,1-3H3,(H,23,26) |
| InChIKey | CLMHPNMUFLRIAN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|