C22H30N2O7S — CID 90116437
N-hydroxy-4-[4-[4-(5-hydroxypentoxy)phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 90116437) has the molecular formula C22H30N2O7S and a molecular weight of 466.56 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-(5-hydroxypentoxy)phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | N-hydroxy-4-[4-[4-(5-hydroxypentoxy)phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 90116437 |
| Molecular Formula | C22H30N2O7S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | N-hydroxy-4-[4-[4-(5-hydroxypentoxy)phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCn1ccc(-c2ccc(OCCCCCO)cc2)cc1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C22H30N2O7S/c1-22(21(27)23-28,32(2,29)30)11-13-24-12-10-18(16-20(24)26)17-6-8-19(9-7-17)31-15-5-3-4-14-25/h6-10,12,16,25,28H,3-5,11,13-15H2,1-2H3,(H,23,27) |
| InChIKey | POGIGNVOKZKHPY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|