C21H28N2O8S — CID 90116127
N-hydroxy-4-[4-[4-(3-hydroxypropoxy)-2-methoxyphenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 90116127) has the molecular formula C21H28N2O8S and a molecular weight of 468.53 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-(3-hydroxypropoxy)-2-methoxyphenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | N-hydroxy-4-[4-[4-(3-hydroxypropoxy)-2-methoxyphenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 90116127 |
| Molecular Formula | C21H28N2O8S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | N-hydroxy-4-[4-[4-(3-hydroxypropoxy)-2-methoxyphenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | COc1cc(OCCCO)ccc1-c1ccn(CCC(C)(C(=O)NO)S(C)(=O)=O)c(=O)c1 |
| InChI | InChI=1S/C21H28N2O8S/c1-21(20(26)22-27,32(3,28)29)8-10-23-9-7-15(13-19(23)25)17-6-5-16(14-18(17)30-2)31-12-4-11-24/h5-7,9,13-14,24,27H,4,8,10-12H2,1-3H3,(H,22,26) |
| InChIKey | KLWYUZHMDZQNMC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|