C25H29F2N3O6S — CID 129217781
(2R)-4-[6-[2,3-difluoro-4-[(2-methoxyethylamino)methyl]phenyl]-1-oxoisoquinolin-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 129217781) has the molecular formula C25H29F2N3O6S and a molecular weight of 537.59 g/mol. Its IUPAC name is (2R)-4-[6-[2,3-difluoro-4-[(2-methoxyethylamino)methyl]phenyl]-1-oxoisoquinolin-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[6-[2,3-difluoro-4-[(2-methoxyethylamino)methyl]phenyl]-1-oxoisoquinolin-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 129217781 |
| Molecular Formula | C25H29F2N3O6S |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | (2R)-4-[6-[2,3-difluoro-4-[(2-methoxyethylamino)methyl]phenyl]-1-oxoisoquinolin-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | COCCNCc1ccc(-c2ccc3c(=O)n(CC[C@](C)(C(=O)NO)S(C)(=O)=O)ccc3c2)c(F)c1F |
| InChI | InChI=1S/C25H29F2N3O6S/c1-25(24(32)29-33,37(3,34)35)9-12-30-11-8-17-14-16(4-7-20(17)23(30)31)19-6-5-18(21(26)22(19)27)15-28-10-13-36-2/h4-8,11,14,28,33H,9-10,12-13,15H2,1-3H3,(H,29,32)/t25-/m1/s1 |
| InChIKey | QYSWHUXPYJWXNS-RUZDIDTESA-N |
| XLogP | 2.38 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|