C27H35ClFN3O6S — CID 137359551
4-[6-[2-fluoro-4-[[(2-methoxy-2-methylpropyl)amino]methyl]phenyl]-1-oxoisoquinolin-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide;hydrochloride (PubChem CID 137359551) has the molecular formula C27H35ClFN3O6S and a molecular weight of 584.11 g/mol. Its IUPAC name is 4-[6-[2-fluoro-4-[[(2-methoxy-2-methylpropyl)amino]methyl]phenyl]-1-oxoisoquinolin-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide;hydrochloride.
| Compound Name | 4-[6-[2-fluoro-4-[[(2-methoxy-2-methylpropyl)amino]methyl]phenyl]-1-oxoisoquinolin-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 137359551 |
| Molecular Formula | C27H35ClFN3O6S |
| Molecular Weight | 584.11 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | 4-[6-[2-fluoro-4-[[(2-methoxy-2-methylpropyl)amino]methyl]phenyl]-1-oxoisoquinolin-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide;hydrochloride |
| SMILES | COC(C)(C)CNCc1ccc(-c2ccc3c(=O)n(CCC(C)(C(=O)NO)S(C)(=O)=O)ccc3c2)c(F)c1.Cl |
| InChI | InChI=1S/C27H34FN3O6S.ClH/c1-26(2,37-4)17-29-16-18-6-8-21(23(28)14-18)19-7-9-22-20(15-19)10-12-31(24(22)32)13-11-27(3,25(33)30-34)38(5,35)36;/h6-10,12,14-15,29,34H,11,13,16-17H2,1-5H3,(H,30,33);1H |
| InChIKey | TXCVQPRLCDZIFE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.11 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|