C30H35N3O7S — CID 175833618
N-benzyl-4-[1-[3-methyl-3-methylsulfonyl-4-(oxan-2-yloxyamino)-4-oxobutyl]-2-oxo-4-pyridinyl]benzamide (PubChem CID 175833618) has the molecular formula C30H35N3O7S and a molecular weight of 581.69 g/mol. Its IUPAC name is N-benzyl-4-[1-[3-methyl-3-methylsulfonyl-4-(oxan-2-yloxyamino)-4-oxobutyl]-2-oxo-4-pyridinyl]benzamide.
| Compound Name | N-benzyl-4-[1-[3-methyl-3-methylsulfonyl-4-(oxan-2-yloxyamino)-4-oxobutyl]-2-oxo-4-pyridinyl]benzamide |
|---|---|
| PubChem CID | 175833618 |
| Molecular Formula | C30H35N3O7S |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | N-benzyl-4-[1-[3-methyl-3-methylsulfonyl-4-(oxan-2-yloxyamino)-4-oxobutyl]-2-oxo-4-pyridinyl]benzamide |
| SMILES | CC(CCn1ccc(-c2ccc(C(=O)NCc3ccccc3)cc2)cc1=O)(C(=O)NOC1CCCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C30H35N3O7S/c1-30(41(2,37)38,29(36)32-40-27-10-6-7-19-39-27)16-18-33-17-15-25(20-26(33)34)23-11-13-24(14-12-23)28(35)31-21-22-8-4-3-5-9-22/h3-5,8-9,11-15,17,20,27H,6-7,10,16,18-19,21H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | CBNHSSJGVFELLN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|