C28H37FN2O8S — CID 86671926
(2R)-4-[4-[2-fluoro-3-methyl-4-(oxan-2-yloxy)phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide (PubChem CID 86671926) has the molecular formula C28H37FN2O8S and a molecular weight of 580.68 g/mol. Its IUPAC name is (2R)-4-[4-[2-fluoro-3-methyl-4-(oxan-2-yloxy)phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide.
| Compound Name | (2R)-4-[4-[2-fluoro-3-methyl-4-(oxan-2-yloxy)phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 86671926 |
| Molecular Formula | C28H37FN2O8S |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | (2R)-4-[4-[2-fluoro-3-methyl-4-(oxan-2-yloxy)phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
| SMILES | Cc1c(OC2CCCCO2)ccc(-c2ccn(CC[C@](C)(C(=O)NOC3CCCCO3)S(C)(=O)=O)c(=O)c2)c1F |
| InChI | InChI=1S/C28H37FN2O8S/c1-19-22(38-24-8-4-6-16-36-24)11-10-21(26(19)29)20-12-14-31(23(32)18-20)15-13-28(2,40(3,34)35)27(33)30-39-25-9-5-7-17-37-25/h10-12,14,18,24-25H,4-9,13,15-17H2,1-3H3,(H,30,33)/t24?,25?,28-/m1/s1 |
| InChIKey | SOJCBZMLUIYUBB-YGBRCLJQSA-N |
| XLogP | 3.64 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|