C21H33BN2O8S — CID 123202291
4-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide (PubChem CID 123202291) has the molecular formula C21H33BN2O8S and a molecular weight of 484.38 g/mol. Its IUPAC name is 4-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide.
| Compound Name | 4-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 123202291 |
| Molecular Formula | C21H33BN2O8S |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 4-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
| SMILES | CC1(C)COB(c2ccn(CCC(C)(C(=O)NOC3CCCCO3)S(C)(=O)=O)c(=O)c2)OC1 |
| InChI | InChI=1S/C21H33BN2O8S/c1-20(2)14-30-22(31-15-20)16-8-10-24(17(25)13-16)11-9-21(3,33(4,27)28)19(26)23-32-18-7-5-6-12-29-18/h8,10,13,18H,5-7,9,11-12,14-15H2,1-4H3,(H,23,26) |
| InChIKey | WNQNVMIZTZHLRO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|