C20H33N3O5S — CID 86710230
(2R)-4-(4-cyclohexylpyrazol-1-yl)-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide (PubChem CID 86710230) has the molecular formula C20H33N3O5S and a molecular weight of 427.57 g/mol. Its IUPAC name is (2R)-4-(4-cyclohexylpyrazol-1-yl)-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide.
| Compound Name | (2R)-4-(4-cyclohexylpyrazol-1-yl)-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 86710230 |
| Molecular Formula | C20H33N3O5S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | (2R)-4-(4-cyclohexylpyrazol-1-yl)-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
| SMILES | C[C@@](CCn1cc(C2CCCCC2)cn1)(C(=O)NOC1CCCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C20H33N3O5S/c1-20(29(2,25)26,19(24)22-28-18-10-6-7-13-27-18)11-12-23-15-17(14-21-23)16-8-4-3-5-9-16/h14-16,18H,3-13H2,1-2H3,(H,22,24)/t18?,20-/m1/s1 |
| InChIKey | HPRQJHRKHKBVIA-ROPPNANJSA-N |
| XLogP | 2.70 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|