C24H29FN4O6S — CID 135315366
4-[6-[4-(3-fluoroazetidin-3-yl)buta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide (PubChem CID 135315366) has the molecular formula C24H29FN4O6S and a molecular weight of 520.58 g/mol. Its IUPAC name is 4-[6-[4-(3-fluoroazetidin-3-yl)buta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide.
| Compound Name | 4-[6-[4-(3-fluoroazetidin-3-yl)buta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 135315366 |
| Molecular Formula | C24H29FN4O6S |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 4-[6-[4-(3-fluoroazetidin-3-yl)buta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
| SMILES | CC(CCN1Cc2cc(C#CC#CC3(F)CNC3)cn2C1=O)(C(=O)NOC1CCCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C24H29FN4O6S/c1-23(36(2,32)33,21(30)27-35-20-8-4-6-12-34-20)10-11-28-15-19-13-18(14-29(19)22(28)31)7-3-5-9-24(25)16-26-17-24/h13-14,20,26H,4,6,8,10-12,15-17H2,1-2H3,(H,27,30) |
| InChIKey | SQLMGZWKGBGSLJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|