C27H33FN2O7S — CID 129217546
(2R)-4-[7-fluoro-6-[4-(2-hydroxyethyl)phenyl]-3-oxo-1H-isoindol-2-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide (PubChem CID 129217546) has the molecular formula C27H33FN2O7S and a molecular weight of 548.63 g/mol. Its IUPAC name is (2R)-4-[7-fluoro-6-[4-(2-hydroxyethyl)phenyl]-3-oxo-1H-isoindol-2-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide.
| Compound Name | (2R)-4-[7-fluoro-6-[4-(2-hydroxyethyl)phenyl]-3-oxo-1H-isoindol-2-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 129217546 |
| Molecular Formula | C27H33FN2O7S |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | (2R)-4-[7-fluoro-6-[4-(2-hydroxyethyl)phenyl]-3-oxo-1H-isoindol-2-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)butanamide |
| SMILES | C[C@@](CCN1Cc2c(ccc(-c3ccc(CCO)cc3)c2F)C1=O)(C(=O)NOC1CCCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C27H33FN2O7S/c1-27(38(2,34)35,26(33)29-37-23-5-3-4-16-36-23)13-14-30-17-22-21(25(30)32)11-10-20(24(22)28)19-8-6-18(7-9-19)12-15-31/h6-11,23,31H,3-5,12-17H2,1-2H3,(H,29,33)/t23?,27-/m1/s1 |
| InChIKey | CXCGNMFPIDNVRA-IQHZPMLTSA-N |
| XLogP | 2.75 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|