C20H20F2N2O5S — CID 129217702
4-[7-fluoro-6-(2-fluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 129217702) has the molecular formula C20H20F2N2O5S and a molecular weight of 438.45 g/mol. Its IUPAC name is 4-[7-fluoro-6-(2-fluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | 4-[7-fluoro-6-(2-fluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 129217702 |
| Molecular Formula | C20H20F2N2O5S |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 4-[7-fluoro-6-(2-fluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCN1Cc2c(ccc(-c3ccccc3F)c2F)C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C20H20F2N2O5S/c1-20(19(26)23-27,30(2,28)29)9-10-24-11-15-14(18(24)25)8-7-13(17(15)22)12-5-3-4-6-16(12)21/h3-8,27H,9-11H2,1-2H3,(H,23,26) |
| InChIKey | BUJKRHISMWYIEZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|