C21H26FN3O8S — CID 129021354
(2R)-4-[6-[4-[(2R)-2,3-dihydroxypropoxy]-2-fluorophenyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 129021354) has the molecular formula C21H26FN3O8S and a molecular weight of 499.52 g/mol. Its IUPAC name is (2R)-4-[6-[4-[(2R)-2,3-dihydroxypropoxy]-2-fluorophenyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[6-[4-[(2R)-2,3-dihydroxypropoxy]-2-fluorophenyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 129021354 |
| Molecular Formula | C21H26FN3O8S |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | (2R)-4-[6-[4-[(2R)-2,3-dihydroxypropoxy]-2-fluorophenyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CCN1Cc2cc(-c3ccc(OC[C@H](O)CO)cc3F)cn2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C21H26FN3O8S/c1-21(19(28)23-30,34(2,31)32)5-6-24-10-14-7-13(9-25(14)20(24)29)17-4-3-16(8-18(17)22)33-12-15(27)11-26/h3-4,7-9,15,26-27,30H,5-6,10-12H2,1-2H3,(H,23,28)/t15-,21-/m1/s1 |
| InChIKey | CHIOONIKMYFXDE-QVKFZJNVSA-N |
| XLogP | 0.51 |
| TPSA | 158.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|