C25H29N5O7S — CID 118368905
N-hydroxy-4-[6-[2-[4-[3-(2-hydroxyethyl)-2-oxoimidazolidin-1-yl]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 118368905) has the molecular formula C25H29N5O7S and a molecular weight of 543.60 g/mol. Its IUPAC name is N-hydroxy-4-[6-[2-[4-[3-(2-hydroxyethyl)-2-oxoimidazolidin-1-yl]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | N-hydroxy-4-[6-[2-[4-[3-(2-hydroxyethyl)-2-oxoimidazolidin-1-yl]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 118368905 |
| Molecular Formula | C25H29N5O7S |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | N-hydroxy-4-[6-[2-[4-[3-(2-hydroxyethyl)-2-oxoimidazolidin-1-yl]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCN1Cc2cc(C#Cc3ccc(N4CCN(CCO)C4=O)cc3)cn2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C25H29N5O7S/c1-25(22(32)26-35,38(2,36)37)9-10-28-17-21-15-19(16-30(21)24(28)34)4-3-18-5-7-20(8-6-18)29-12-11-27(13-14-31)23(29)33/h5-8,15-16,31,35H,9-14,17H2,1-2H3,(H,26,32) |
| InChIKey | JRGZKHZDDOGZDV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 152.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|