C22H25N3O7S — CID 127037549
(2R)-N-hydroxy-4-[6-[2-[4-(2-hydroxyethoxy)phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 127037549) has the molecular formula C22H25N3O7S and a molecular weight of 475.52 g/mol. Its IUPAC name is (2R)-N-hydroxy-4-[6-[2-[4-(2-hydroxyethoxy)phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-N-hydroxy-4-[6-[2-[4-(2-hydroxyethoxy)phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 127037549 |
| Molecular Formula | C22H25N3O7S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | (2R)-N-hydroxy-4-[6-[2-[4-(2-hydroxyethoxy)phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CCN1Cc2cc(C#Cc3ccc(OCCO)cc3)cn2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C22H25N3O7S/c1-22(20(27)23-29,33(2,30)31)9-10-24-15-18-13-17(14-25(18)21(24)28)4-3-16-5-7-19(8-6-16)32-12-11-26/h5-8,13-14,26,29H,9-12,15H2,1-2H3,(H,23,27)/t22-/m1/s1 |
| InChIKey | RDIRBOSPSSTONL-JOCHJYFZSA-N |
| XLogP | 0.74 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|