C22H23FN4O7S — CID 129021449
4-[6-[2-[3-fluoro-4-[(2-hydroxyacetyl)amino]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 129021449) has the molecular formula C22H23FN4O7S and a molecular weight of 506.51 g/mol. Its IUPAC name is 4-[6-[2-[3-fluoro-4-[(2-hydroxyacetyl)amino]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | 4-[6-[2-[3-fluoro-4-[(2-hydroxyacetyl)amino]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 129021449 |
| Molecular Formula | C22H23FN4O7S |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 4-[6-[2-[3-fluoro-4-[(2-hydroxyacetyl)amino]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCN1Cc2cc(C#Cc3ccc(NC(=O)CO)c(F)c3)cn2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C22H23FN4O7S/c1-22(20(30)25-32,35(2,33)34)7-8-26-12-16-9-15(11-27(16)21(26)31)4-3-14-5-6-18(17(23)10-14)24-19(29)13-28/h5-6,9-11,28,32H,7-8,12-13H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | HLQGYNLTEVQWFK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 158.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|