C22H27N3O7S — CID 129021443
N-hydroxy-4-[6-[5-[1-hydroxy-3-(hydroxymethyl)cyclobutyl]penta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 129021443) has the molecular formula C22H27N3O7S and a molecular weight of 477.54 g/mol. Its IUPAC name is N-hydroxy-4-[6-[5-[1-hydroxy-3-(hydroxymethyl)cyclobutyl]penta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | N-hydroxy-4-[6-[5-[1-hydroxy-3-(hydroxymethyl)cyclobutyl]penta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 129021443 |
| Molecular Formula | C22H27N3O7S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | N-hydroxy-4-[6-[5-[1-hydroxy-3-(hydroxymethyl)cyclobutyl]penta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCN1Cc2cc(C#CC#CCC3(O)CC(CO)C3)cn2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C22H27N3O7S/c1-21(19(27)23-30,33(2,31)32)8-9-24-14-18-10-16(13-25(18)20(24)28)6-4-3-5-7-22(29)11-17(12-22)15-26/h10,13,17,26,29-30H,7-9,11-12,14-15H2,1-2H3,(H,23,27) |
| InChIKey | PYBJJZHNHNRZHR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 149.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|