C20H23FN3O9PS — CID 135306917
[(1R,2R)-1-fluoro-2-[4-[2-[(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-6-yl]buta-1,3-diynyl]cyclopropyl]methyl dihydrogen phosphate (PubChem CID 135306917) has the molecular formula C20H23FN3O9PS and a molecular weight of 531.46 g/mol. Its IUPAC name is [(1R,2R)-1-fluoro-2-[4-[2-[(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-6-yl]buta-1,3-diynyl]cyclopropyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,2R)-1-fluoro-2-[4-[2-[(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-6-yl]buta-1,3-diynyl]cyclopropyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135306917 |
| Molecular Formula | C20H23FN3O9PS |
| Molecular Weight | 531.46 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | [(1R,2R)-1-fluoro-2-[4-[2-[(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-6-yl]buta-1,3-diynyl]cyclopropyl]methyl dihydrogen phosphate |
| SMILES | C[C@@](CCN1Cc2cc(C#CC#C[C@H]3C[C@]3(F)COP(=O)(O)O)cn2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C20H23FN3O9PS/c1-19(17(25)22-27,35(2,31)32)7-8-23-12-16-9-14(11-24(16)18(23)26)5-3-4-6-15-10-20(15,21)13-33-34(28,29)30/h9,11,15,27H,7-8,10,12-13H2,1-2H3,(H,22,25)(H2,28,29,30)/t15-,19+,20-/m0/s1 |
| InChIKey | SADNYYZUTLMJAA-BEVDRBHNSA-N |
| XLogP | 0.16 |
| TPSA | 175.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.46 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|