C25H31N5O5S — CID 129021406
4-[6-[2-[4-(4-aminopiperidin-1-yl)phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 129021406) has the molecular formula C25H31N5O5S and a molecular weight of 513.62 g/mol. Its IUPAC name is 4-[6-[2-[4-(4-aminopiperidin-1-yl)phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | 4-[6-[2-[4-(4-aminopiperidin-1-yl)phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 129021406 |
| Molecular Formula | C25H31N5O5S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 4-[6-[2-[4-(4-aminopiperidin-1-yl)phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCN1Cc2cc(C#Cc3ccc(N4CCC(N)CC4)cc3)cn2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C25H31N5O5S/c1-25(23(31)27-33,36(2,34)35)11-14-29-17-22-15-19(16-30(22)24(29)32)4-3-18-5-7-21(8-6-18)28-12-9-20(26)10-13-28/h5-8,15-16,20,33H,9-14,17,26H2,1-2H3,(H,27,31) |
| InChIKey | XMJOZVFYCHJWDB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 137.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|