C26H32N4O6S — CID 118368767
(2R)-N-hydroxy-4-[6-[2-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 118368767) has the molecular formula C26H32N4O6S and a molecular weight of 528.63 g/mol. Its IUPAC name is (2R)-N-hydroxy-4-[6-[2-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-N-hydroxy-4-[6-[2-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 118368767 |
| Molecular Formula | C26H32N4O6S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | (2R)-N-hydroxy-4-[6-[2-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CCN1Cc2cc(C#Cc3ccc(CN4CCC(O)CC4)cc3)cn2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C26H32N4O6S/c1-26(24(32)27-34,37(2,35)36)11-14-29-18-22-15-21(17-30(22)25(29)33)8-5-19-3-6-20(7-4-19)16-28-12-9-23(31)10-13-28/h3-4,6-7,15,17,23,31,34H,9-14,16,18H2,1-2H3,(H,27,32)/t26-/m1/s1 |
| InChIKey | GOYAUJANLIFMKB-AREMUKBSSA-N |
| XLogP | 1.33 |
| TPSA | 132.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|