C24H26FN3O6S — CID 129021551
(2R)-4-[6-[2-[2-fluoro-4-[1-(hydroxymethyl)cyclopropyl]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 129021551) has the molecular formula C24H26FN3O6S and a molecular weight of 503.55 g/mol. Its IUPAC name is (2R)-4-[6-[2-[2-fluoro-4-[1-(hydroxymethyl)cyclopropyl]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[6-[2-[2-fluoro-4-[1-(hydroxymethyl)cyclopropyl]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 129021551 |
| Molecular Formula | C24H26FN3O6S |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | (2R)-4-[6-[2-[2-fluoro-4-[1-(hydroxymethyl)cyclopropyl]phenyl]ethynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CCN1Cc2cc(C#Cc3ccc(C4(CO)CC4)cc3F)cn2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C24H26FN3O6S/c1-23(21(30)26-32,35(2,33)34)9-10-27-14-19-11-16(13-28(19)22(27)31)3-4-17-5-6-18(12-20(17)25)24(15-29)7-8-24/h5-6,11-13,29,32H,7-10,14-15H2,1-2H3,(H,26,30)/t23-/m1/s1 |
| InChIKey | JBMXFSJHNHJAMZ-HSZRJFAPSA-N |
| XLogP | 1.53 |
| TPSA | 128.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|