C18H21FN2O6S — CID 88880231
(2R)-4-[5-fluoro-2-oxo-4-[4-(trideuteriomethoxy)phenyl]-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 88880231) has the molecular formula C18H21FN2O6S and a molecular weight of 415.46 g/mol. Its IUPAC name is (2R)-4-[5-fluoro-2-oxo-4-[4-(trideuteriomethoxy)phenyl]-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[5-fluoro-2-oxo-4-[4-(trideuteriomethoxy)phenyl]-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 88880231 |
| Molecular Formula | C18H21FN2O6S |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | (2R)-4-[5-fluoro-2-oxo-4-[4-(trideuteriomethoxy)phenyl]-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | [2H]C([2H])([2H])Oc1ccc(-c2cc(=O)n(CC[C@](C)(C(=O)NO)S(C)(=O)=O)cc2F)cc1 |
| InChI | InChI=1S/C18H21FN2O6S/c1-18(17(23)20-24,28(3,25)26)8-9-21-11-15(19)14(10-16(21)22)12-4-6-13(27-2)7-5-12/h4-7,10-11,24H,8-9H2,1-3H3,(H,20,23)/t18-/m1/s1/i2D3 |
| InChIKey | JEFDQIGURWTOGB-IATFMEIASA-N |
| XLogP | 1.36 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|